Balance The Equation NH3 + O2 -----> NO + H2O

manpreetsamra manpreetsamra

• 03.07.2018
• Chemistry
• Secondary School

answered • expert verified Balance the equation NH3 + O2 -----> NO + H2O See answers RomeliaThurston RomeliaThurston

Answer: The balanced chemical equation is given below.

Explanation:

Every balanced chemical equation follows law of conservation of mass. This law states that mass can neither be created nor be destroyed. The individual atoms on the reactant side is always equal to the individual atoms on the product side.

For the given chemical equation, the balanced equation follows:

By Stoichiometry of the reaction:

4 moles of ammonia reacts with 5 moles of oxygen gas to produce 4 moles of nitric oxide and 6 moles of water.

Thus, the balanced chemical equation is given below.

prachikalantri prachikalantri

Answer: The balanced chemical equation is given below.

Explanation:

The law of mass conservation governs every balanced chemical equation. According to this law, mass cannot be generated or destroyed. On the reactant side, the individual atoms are always equivalent to the individual atoms on the product side.

For the given chemical equation, the balanced equation follows:

By Stoichiometry of the reaction:

4 moles ammonia react with 5 moles oxygen to form 4 moles nitric oxide and 6 moles water.

As a result, the balanced chemical equation is as follows.

#SPJ2

New questions in Chemistry

how to make anti iron chemical​ CH3CH2CH2CH2CH2-CH(CH3CH2)-CH3​ Derive the relation between Kp and Kc.​ 3. (क) मोलल उन्नयन स्थिरांक को परिभाषित कीजिए। किसी विलेय के मोलर द्रव्यमान तथा मोलल उन्नयन स्थिरांक के बीच संबंध व्युत्पन्न कीजिए । ​ Write a short note on wurtz reaction.​ Previous Next