How To Balance This Equation ? CH4+O2 = Co2+H2O

abhinav1112 abhinav1112

• 03.01.2018
• Chemistry
• Secondary School

answered • expert verified How to balance this equation ? CH4+O2 = Co2+H2O See answers zumba12 zumba12

Balancing equation

Explanation:

• In the given reaction, methane is reacting with oxygen to produce carbon dioxide and water.

• The chemical equation involved is

• When the number of atoms for the reactant side is calculated it gives:

C = 1

H = 4

O = 2

• When the number of atoms for the product side is calculated it gives:

C = 1

H = 2

O = 3

• The obtained result indicates that the atoms of hydrogen and oxygen are not equal on both sides. Thus the reaction is not balanced.
• The balanced reaction has the number of atoms involved in reaction in reactants as well as the product is equal.
• To make both side equal some changes must be made as shown in the balanced equation is

• For the above equation, the number of atoms in the reactants is:

C = 1

H = 4

O = 4

• The number of atoms in products is:

C = 1

H = 4

O = 4

• As the number of atoms in the reactants side is equal to the number of atoms in the product side, the reaction is balanced.

Learn more about balancing chemical equation

Why is it necessary to balance chemical equation?

brainly.in/question/3347776

Write the steps for balancing the chemical equation for the formation of ammonia by the combination of nitrogen and hydrogen.

brainly.in/question/671546

nitin103 nitin103 CH4+2O2=CO2+2H2O....M

New questions in Chemistry

Water ka color universal indicator mein kya hota hai? Write the IUPAC names and bond line structure of the following organic compound CH3CH(CHO)CH2CH(CH3)CH(CH3)COBr A mixture of 2× 10²¹molecules of p 3 ×10²¹molecules of cube weight 0.60 g if the molecular mass of p is 45 then the molecular mass of Q will be Why do Ce and Tb shows+4 oxidation state? A Question : NH4^+ এর সংকরায়ন ব্যাখ্যা কর? ​ Previous Next